C15H20N4O3S2 — CID 121029412
N-[5-[2-(diethylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2,5-dimethylfuran-3-carboxamide (PubChem CID 121029412) has the molecular formula C15H20N4O3S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-[5-[2-(diethylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-[5-[2-(diethylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 121029412 |
| Molecular Formula | C15H20N4O3S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N-[5-[2-(diethylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2,5-dimethylfuran-3-carboxamide |
| SMILES | CCN(CC)C(=O)CSc1nnc(NC(=O)c2cc(C)oc2C)s1 |
| InChI | InChI=1S/C15H20N4O3S2/c1-5-19(6-2)12(20)8-23-15-18-17-14(24-15)16-13(21)11-7-9(3)22-10(11)4/h7H,5-6,8H2,1-4H3,(H,16,17,21) |
| InChIKey | KHLDLUOHJIGOKY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|