C11H13N5O3S2 — CID 121029311
N-[5-[2-(ethylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 121029311) has the molecular formula C11H13N5O3S2 and a molecular weight of 327.39 g/mol. Its IUPAC name is N-[5-[2-(ethylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[5-[2-(ethylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 121029311 |
| Molecular Formula | C11H13N5O3S2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | N-[5-[2-(ethylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | CCNC(=O)CSc1nnc(NC(=O)c2cc(C)on2)s1 |
| InChI | InChI=1S/C11H13N5O3S2/c1-3-12-8(17)5-20-11-15-14-10(21-11)13-9(18)7-4-6(2)19-16-7/h4H,3,5H2,1-2H3,(H,12,17)(H,13,14,18) |
| InChIKey | MKFGOUFDCYDGNG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|