C22H18N6O4S2 — CID 121030285
N-[5-[2-(4-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 121030285) has the molecular formula C22H18N6O4S2 and a molecular weight of 494.56 g/mol. Its IUPAC name is N-[5-[2-(4-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[5-[2-(4-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 121030285 |
| Molecular Formula | C22H18N6O4S2 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | N-[5-[2-(4-acetamidoanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)CSc2nnc(NC(=O)c3cc(-c4ccccc4)on3)s2)cc1 |
| InChI | InChI=1S/C22H18N6O4S2/c1-13(29)23-15-7-9-16(10-8-15)24-19(30)12-33-22-27-26-21(34-22)25-20(31)17-11-18(32-28-17)14-5-3-2-4-6-14/h2-11H,12H2,1H3,(H,23,29)(H,24,30)(H,25,26,31) |
| InChIKey | SIKPNHBKCPJSLP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 139.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|