C21H13ClF3N5O3S2 — CID 121030277
N-[5-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 121030277) has the molecular formula C21H13ClF3N5O3S2 and a molecular weight of 539.95 g/mol. Its IUPAC name is N-[5-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[5-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 121030277 |
| Molecular Formula | C21H13ClF3N5O3S2 |
| Molecular Weight | 539.95 g/mol |
| Exact Mass | 539.01 |
| IUPAC Name | N-[5-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2cc(-c3ccccc3)on2)s1)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C21H13ClF3N5O3S2/c22-13-7-6-12(21(23,24)25)8-14(13)26-17(31)10-34-20-29-28-19(35-20)27-18(32)15-9-16(33-30-15)11-4-2-1-3-5-11/h1-9H,10H2,(H,26,31)(H,27,28,32) |
| InChIKey | MIWCCADZGGRFDS-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.95 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|