C18H10Cl3F3N4O2S2 — CID 44956982
3,5-dichloro-N-[5-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 44956982) has the molecular formula C18H10Cl3F3N4O2S2 and a molecular weight of 541.79 g/mol. Its IUPAC name is 3,5-dichloro-N-[5-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3,5-dichloro-N-[5-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 44956982 |
| Molecular Formula | C18H10Cl3F3N4O2S2 |
| Molecular Weight | 541.79 g/mol |
| Exact Mass | 539.93 |
| IUPAC Name | 3,5-dichloro-N-[5-[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2cc(Cl)cc(Cl)c2)s1)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C18H10Cl3F3N4O2S2/c19-10-3-8(4-11(20)6-10)15(30)26-16-27-28-17(32-16)31-7-14(29)25-13-5-9(18(22,23)24)1-2-12(13)21/h1-6H,7H2,(H,25,29)(H,26,27,30) |
| InChIKey | DBAHLORTCXZUKN-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.79 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|