C17H13Cl2N5O3S2 — CID 121030030
5-cyclopropyl-N-[5-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1,2-oxazole-3-carboxamide (PubChem CID 121030030) has the molecular formula C17H13Cl2N5O3S2 and a molecular weight of 470.36 g/mol. Its IUPAC name is 5-cyclopropyl-N-[5-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-cyclopropyl-N-[5-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 121030030 |
| Molecular Formula | C17H13Cl2N5O3S2 |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 468.98 |
| IUPAC Name | 5-cyclopropyl-N-[5-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2cc(C3CC3)on2)s1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H13Cl2N5O3S2/c18-10-4-3-9(5-11(10)19)20-14(25)7-28-17-23-22-16(29-17)21-15(26)12-6-13(27-24-12)8-1-2-8/h3-6,8H,1-2,7H2,(H,20,25)(H,21,22,26) |
| InChIKey | ORWYMTNZZRFUPT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|