C20H17N5O5S2 — CID 121030157
N-[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide (PubChem CID 121030157) has the molecular formula C20H17N5O5S2 and a molecular weight of 471.52 g/mol. Its IUPAC name is N-[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 121030157 |
| Molecular Formula | C20H17N5O5S2 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | N-[5-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide |
| SMILES | CCOc1ccc(NC(=O)CSc2nnc(NC(=O)c3cc(-c4ccco4)on3)s2)cc1 |
| InChI | InChI=1S/C20H17N5O5S2/c1-2-28-13-7-5-12(6-8-13)21-17(26)11-31-20-24-23-19(32-20)22-18(27)14-10-16(30-25-14)15-4-3-9-29-15/h3-10H,2,11H2,1H3,(H,21,26)(H,22,23,27) |
| InChIKey | CZCRYPFIHSVEAS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 132.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|