C19H15N5O4S2 — CID 121030178
N-[5-[2-(benzylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide (PubChem CID 121030178) has the molecular formula C19H15N5O4S2 and a molecular weight of 441.49 g/mol. Its IUPAC name is N-[5-[2-(benzylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-[5-[2-(benzylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 121030178 |
| Molecular Formula | C19H15N5O4S2 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | N-[5-[2-(benzylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-(furan-2-yl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(CSc1nnc(NC(=O)c2cc(-c3ccco3)on2)s1)NCc1ccccc1 |
| InChI | InChI=1S/C19H15N5O4S2/c25-16(20-10-12-5-2-1-3-6-12)11-29-19-23-22-18(30-19)21-17(26)13-9-15(28-24-13)14-7-4-8-27-14/h1-9H,10-11H2,(H,20,25)(H,21,22,26) |
| InChIKey | SBLPXWXOKAINIB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 123.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|