C16H15N5O4S2 — CID 121029270
N-[5-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 121029270) has the molecular formula C16H15N5O4S2 and a molecular weight of 405.46 g/mol. Its IUPAC name is N-[5-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[5-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 121029270 |
| Molecular Formula | C16H15N5O4S2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | N-[5-[2-(3-methoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | COc1cccc(NC(=O)CSc2nnc(NC(=O)c3cc(C)on3)s2)c1 |
| InChI | InChI=1S/C16H15N5O4S2/c1-9-6-12(21-25-9)14(23)18-15-19-20-16(27-15)26-8-13(22)17-10-4-3-5-11(7-10)24-2/h3-7H,8H2,1-2H3,(H,17,22)(H,18,19,23) |
| InChIKey | ZASMGRPNZBPDHS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|