C14H18N4O4S2 — CID 121029419
N-[5-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2,5-dimethylfuran-3-carboxamide (PubChem CID 121029419) has the molecular formula C14H18N4O4S2 and a molecular weight of 370.46 g/mol. Its IUPAC name is N-[5-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-[5-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 121029419 |
| Molecular Formula | C14H18N4O4S2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | N-[5-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2,5-dimethylfuran-3-carboxamide |
| SMILES | COCCNC(=O)CSc1nnc(NC(=O)c2cc(C)oc2C)s1 |
| InChI | InChI=1S/C14H18N4O4S2/c1-8-6-10(9(2)22-8)12(20)16-13-17-18-14(24-13)23-7-11(19)15-4-5-21-3/h6H,4-5,7H2,1-3H3,(H,15,19)(H,16,17,20) |
| InChIKey | DDJITLUMDBJBGD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|