C18H19N3O4S2 — CID 121029444
N-[5-[(3,5-dimethoxyphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2,5-dimethylfuran-3-carboxamide (PubChem CID 121029444) has the molecular formula C18H19N3O4S2 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[5-[(3,5-dimethoxyphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-[5-[(3,5-dimethoxyphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 121029444 |
| Molecular Formula | C18H19N3O4S2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | N-[5-[(3,5-dimethoxyphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2,5-dimethylfuran-3-carboxamide |
| SMILES | COc1cc(CSc2nnc(NC(=O)c3cc(C)oc3C)s2)cc(OC)c1 |
| InChI | InChI=1S/C18H19N3O4S2/c1-10-5-15(11(2)25-10)16(22)19-17-20-21-18(27-17)26-9-12-6-13(23-3)8-14(7-12)24-4/h5-8H,9H2,1-4H3,(H,19,20,22) |
| InChIKey | OWIWDRFLYSMYKL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|