C18H18N4O4S2 — CID 56766184
5-cyclopropyl-N-[5-[(3,5-dimethoxyphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1,2-oxazole-3-carboxamide (PubChem CID 56766184) has the molecular formula C18H18N4O4S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 5-cyclopropyl-N-[5-[(3,5-dimethoxyphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-cyclopropyl-N-[5-[(3,5-dimethoxyphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 56766184 |
| Molecular Formula | C18H18N4O4S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 5-cyclopropyl-N-[5-[(3,5-dimethoxyphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1,2-oxazole-3-carboxamide |
| SMILES | COc1cc(CSc2nnc(NC(=O)c3cc(C4CC4)on3)s2)cc(OC)c1 |
| InChI | InChI=1S/C18H18N4O4S2/c1-24-12-5-10(6-13(7-12)25-2)9-27-18-21-20-17(28-18)19-16(23)14-8-15(26-22-14)11-3-4-11/h5-8,11H,3-4,9H2,1-2H3,(H,19,20,23) |
| InChIKey | ZATSAAWNTLGCOT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 99.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|