C16H13N5O4S2 — CID 121030094
5-cyclopropyl-N-[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1,2-oxazole-3-carboxamide (PubChem CID 121030094) has the molecular formula C16H13N5O4S2 and a molecular weight of 403.45 g/mol. Its IUPAC name is 5-cyclopropyl-N-[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-cyclopropyl-N-[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 121030094 |
| Molecular Formula | C16H13N5O4S2 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 5-cyclopropyl-N-[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(Nc1nnc(SCc2ccc([N+](=O)[O-])cc2)s1)c1cc(C2CC2)on1 |
| InChI | InChI=1S/C16H13N5O4S2/c22-14(12-7-13(25-20-12)10-3-4-10)17-15-18-19-16(27-15)26-8-9-1-5-11(6-2-9)21(23)24/h1-2,5-7,10H,3-4,8H2,(H,17,18,22) |
| InChIKey | LQQYAVWINDVTLF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 124.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|