C19H16N8O4S4 — CID 72735841
N,N'-bis[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]methanediamine (PubChem CID 72735841) has the molecular formula C19H16N8O4S4 and a molecular weight of 548.66 g/mol. Its IUPAC name is N,N'-bis[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]methanediamine.
| Compound Name | N,N'-bis[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]methanediamine |
|---|---|
| PubChem CID | 72735841 |
| Molecular Formula | C19H16N8O4S4 |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.02 |
| IUPAC Name | N,N'-bis[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]methanediamine |
| SMILES | O=[N+]([O-])c1ccc(CSc2nnc(NCNc3nnc(SCc4ccc([N+](=O)[O-])cc4)s3)s2)cc1 |
| InChI | InChI=1S/C19H16N8O4S4/c28-26(29)14-5-1-12(2-6-14)9-32-18-24-22-16(34-18)20-11-21-17-23-25-19(35-17)33-10-13-3-7-15(8-4-13)27(30)31/h1-8H,9-11H2,(H,20,22)(H,21,23) |
| InChIKey | SEHLIIFIFQBNHL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 161.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|