C21H20N4O6S2 — CID 4565450
N-[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 4565450) has the molecular formula C21H20N4O6S2 and a molecular weight of 488.55 g/mol. Its IUPAC name is N-[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | N-[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4565450 |
| Molecular Formula | C21H20N4O6S2 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | N-[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2nnc(SCc3ccc([N+](=O)[O-])cc3)s2)cc(OC)c1OC |
| InChI | InChI=1S/C21H20N4O6S2/c1-29-16-10-14(11-17(30-2)19(16)31-3)6-9-18(26)22-20-23-24-21(33-20)32-12-13-4-7-15(8-5-13)25(27)28/h4-11H,12H2,1-3H3,(H,22,23,26) |
| InChIKey | MNIZRBYOTBWHFC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|