C20H18N4O5S2 — CID 40827651
(E)-3-(3,4-dimethoxyphenyl)-N-[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 40827651) has the molecular formula C20H18N4O5S2 and a molecular weight of 458.52 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 40827651 |
| Molecular Formula | C20H18N4O5S2 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2nnc(SCc3ccc([N+](=O)[O-])cc3)s2)cc1OC |
| InChI | InChI=1S/C20H18N4O5S2/c1-28-16-9-5-13(11-17(16)29-2)6-10-18(25)21-19-22-23-20(31-19)30-12-14-3-7-15(8-4-14)24(26)27/h3-11H,12H2,1-2H3,(H,21,22,25)/b10-6+ |
| InChIKey | NOOQKAPXQKVJFR-UXBLZVDNSA-N |
| XLogP | 4.41 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|