C18H18N2O5 — CID 17070188
(E)-N-[(3,4-dimethoxyphenyl)methyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 17070188) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is (E)-N-[(3,4-dimethoxyphenyl)methyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[(3,4-dimethoxyphenyl)methyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17070188 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (E)-N-[(3,4-dimethoxyphenyl)methyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | COc1ccc(CNC(=O)/C=C/c2ccc([N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C18H18N2O5/c1-24-16-9-5-14(11-17(16)25-2)12-19-18(21)10-6-13-3-7-15(8-4-13)20(22)23/h3-11H,12H2,1-2H3,(H,19,21)/b10-6+ |
| InChIKey | PLFSCHVIAJZKLE-UXBLZVDNSA-N |
| XLogP | 2.94 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|