C17H18N2O6 — CID 4064527
(4-nitrophenyl)methyl N-[(3,4-dimethoxyphenyl)methyl]carbamate (PubChem CID 4064527) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[(3,4-dimethoxyphenyl)methyl]carbamate.
| Compound Name | (4-nitrophenyl)methyl N-[(3,4-dimethoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 4064527 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (4-nitrophenyl)methyl N-[(3,4-dimethoxyphenyl)methyl]carbamate |
| SMILES | COc1ccc(CNC(=O)OCc2ccc([N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C17H18N2O6/c1-23-15-8-5-13(9-16(15)24-2)10-18-17(20)25-11-12-3-6-14(7-4-12)19(21)22/h3-9H,10-11H2,1-2H3,(H,18,20) |
| InChIKey | NBRDGAGPSBQYDA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|