C15H13ClN2O6 — CID 22600008
(4-nitrophenyl)methyl N-(2-chloro-5-hydroxy-4-methoxyphenyl)carbamate (PubChem CID 22600008) has the molecular formula C15H13ClN2O6 and a molecular weight of 352.73 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-(2-chloro-5-hydroxy-4-methoxyphenyl)carbamate.
| Compound Name | (4-nitrophenyl)methyl N-(2-chloro-5-hydroxy-4-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 22600008 |
| Molecular Formula | C15H13ClN2O6 |
| Molecular Weight | 352.73 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | (4-nitrophenyl)methyl N-(2-chloro-5-hydroxy-4-methoxyphenyl)carbamate |
| SMILES | COc1cc(Cl)c(NC(=O)OCc2ccc([N+](=O)[O-])cc2)cc1O |
| InChI | InChI=1S/C15H13ClN2O6/c1-23-14-6-11(16)12(7-13(14)19)17-15(20)24-8-9-2-4-10(5-3-9)18(21)22/h2-7,19H,8H2,1H3,(H,17,20) |
| InChIKey | MXJCZXMQYSCUMM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.73 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|