C16H12F2N2O6 — CID 169223443
methyl 4,5-difluoro-2-[(4-nitrophenyl)methoxycarbonylamino]benzoate (PubChem CID 169223443) has the molecular formula C16H12F2N2O6 and a molecular weight of 366.28 g/mol. Its IUPAC name is methyl 4,5-difluoro-2-[(4-nitrophenyl)methoxycarbonylamino]benzoate.
| Compound Name | methyl 4,5-difluoro-2-[(4-nitrophenyl)methoxycarbonylamino]benzoate |
|---|---|
| PubChem CID | 169223443 |
| Molecular Formula | C16H12F2N2O6 |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | methyl 4,5-difluoro-2-[(4-nitrophenyl)methoxycarbonylamino]benzoate |
| SMILES | COC(=O)c1cc(F)c(F)cc1NC(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H12F2N2O6/c1-25-15(21)11-6-12(17)13(18)7-14(11)19-16(22)26-8-9-2-4-10(5-3-9)20(23)24/h2-7H,8H2,1H3,(H,19,22) |
| InChIKey | FBEUDZPMJGRTLH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|