C17H14F2N2O6 — CID 169223544
methyl 4,5-difluoro-2-[(3-methyl-2-nitrophenyl)methoxycarbonylamino]benzoate (PubChem CID 169223544) has the molecular formula C17H14F2N2O6 and a molecular weight of 380.30 g/mol. Its IUPAC name is methyl 4,5-difluoro-2-[(3-methyl-2-nitrophenyl)methoxycarbonylamino]benzoate.
| Compound Name | methyl 4,5-difluoro-2-[(3-methyl-2-nitrophenyl)methoxycarbonylamino]benzoate |
|---|---|
| PubChem CID | 169223544 |
| Molecular Formula | C17H14F2N2O6 |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | methyl 4,5-difluoro-2-[(3-methyl-2-nitrophenyl)methoxycarbonylamino]benzoate |
| SMILES | COC(=O)c1cc(F)c(F)cc1NC(=O)OCc1cccc(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14F2N2O6/c1-9-4-3-5-10(15(9)21(24)25)8-27-17(23)20-14-7-13(19)12(18)6-11(14)16(22)26-2/h3-7H,8H2,1-2H3,(H,20,23) |
| InChIKey | DJPYLPYYIPJZRI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|