About 1-O-ethyl 10-O-[(3-methyl-2-nitrophenyl)methyl] decanedioate
1-O-ethyl 10-O-[(3-methyl-2-nitrophenyl)methyl] decanedioate (PubChem CID 91720215) has the molecular formula C20H29NO6
and a molecular weight of 379.45 g/mol. Its IUPAC name is 1-O-ethyl 10-O-[(3-methyl-2-nitrophenyl)methyl] decanedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 10-O-[(3-methyl-2-nitrophenyl)methyl] decanedioate |
| PubChem CID | 91720215 |
| Molecular Formula | C20H29NO6 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 1-O-ethyl 10-O-[(3-methyl-2-nitrophenyl)methyl] decanedioate |
| SMILES | CCOC(=O)CCCCCCCCC(=O)OCc1cccc(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H29NO6/c1-3-26-18(22)13-8-6-4-5-7-9-14-19(23)27-15-17-12-10-11-16(2)20(17)21(24)25/h10-12H,3-9,13-15H2,1-2H3 |
| InChIKey | AYXMUETXQZUDQF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 10-O-[(3-methyl-2-nitrophenyl)methyl] decanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 10-O-[(3-methyl-2-nitrophenyl)methyl] decanedioate?
The IUPAC name of 1-O-ethyl 10-O-[(3-methyl-2-nitrophenyl)methyl] decanedioate (CID 91720215) is 1-O-ethyl 10-O-[(3-methyl-2-nitrophenyl)methyl] decanedioate.
What is the SMILES notation for 1-O-ethyl 10-O-[(3-methyl-2-nitrophenyl)methyl] decanedioate?
The canonical SMILES for 1-O-ethyl 10-O-[(3-methyl-2-nitrophenyl)methyl] decanedioate is CCOC(=O)CCCCCCCCC(=O)OCc1cccc(C)c1[N+](=O)[O-].
What is the InChIKey of 1-O-ethyl 10-O-[(3-methyl-2-nitrophenyl)methyl] decanedioate?
The InChIKey is AYXMUETXQZUDQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29NO6/c1-3-26-18(22)13-8-6-4-5-7-9-14-19(23)27-15-17-12-10-11-16(2)20(17)21(24)25/h10-12H,3-9,13-15H2,1-2H3.
What are the key properties of 1-O-ethyl 10-O-[(3-methyl-2-nitrophenyl)methyl] decanedioate?
1-O-ethyl 10-O-[(3-methyl-2-nitrophenyl)methyl] decanedioate has a molecular weight of 379.45 g/mol, XLogP of 4.63, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 10-O-[(3-methyl-2-nitrophenyl)methyl] decanedioate is sourced from PubChem (CID 91720215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).