C24H29NO6 — CID 91720224
2-O-[(3-methyl-2-nitrophenyl)methyl] 1-O-octyl benzene-1,2-dicarboxylate (PubChem CID 91720224) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is 2-O-[(3-methyl-2-nitrophenyl)methyl] 1-O-octyl benzene-1,2-dicarboxylate.
| Compound Name | 2-O-[(3-methyl-2-nitrophenyl)methyl] 1-O-octyl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 91720224 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 2-O-[(3-methyl-2-nitrophenyl)methyl] 1-O-octyl benzene-1,2-dicarboxylate |
| SMILES | CCCCCCCCOC(=O)c1ccccc1C(=O)OCc1cccc(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C24H29NO6/c1-3-4-5-6-7-10-16-30-23(26)20-14-8-9-15-21(20)24(27)31-17-19-13-11-12-18(2)22(19)25(28)29/h8-9,11-15H,3-7,10,16-17H2,1-2H3 |
| InChIKey | NJTXWVHQEGRVJC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|