C19H27NO6 — CID 91720942
4-O-(2-methylhexan-3-yl) 1-O-[(3-methyl-2-nitrophenyl)methyl] butanedioate (PubChem CID 91720942) has the molecular formula C19H27NO6 and a molecular weight of 365.43 g/mol. Its IUPAC name is 4-O-(2-methylhexan-3-yl) 1-O-[(3-methyl-2-nitrophenyl)methyl] butanedioate.
| Compound Name | 4-O-(2-methylhexan-3-yl) 1-O-[(3-methyl-2-nitrophenyl)methyl] butanedioate |
|---|---|
| PubChem CID | 91720942 |
| Molecular Formula | C19H27NO6 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 4-O-(2-methylhexan-3-yl) 1-O-[(3-methyl-2-nitrophenyl)methyl] butanedioate |
| SMILES | CCCC(OC(=O)CCC(=O)OCc1cccc(C)c1[N+](=O)[O-])C(C)C |
| InChI | InChI=1S/C19H27NO6/c1-5-7-16(13(2)3)26-18(22)11-10-17(21)25-12-15-9-6-8-14(4)19(15)20(23)24/h6,8-9,13,16H,5,7,10-12H2,1-4H3 |
| InChIKey | UHNVYUWZFYECNJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|