C18H25FO4 — CID 91704442
1-O-[(4-fluorophenyl)methyl] 4-O-(2-methylhexan-3-yl) butanedioate (PubChem CID 91704442) has the molecular formula C18H25FO4 and a molecular weight of 324.39 g/mol. Its IUPAC name is 1-O-[(4-fluorophenyl)methyl] 4-O-(2-methylhexan-3-yl) butanedioate.
| Compound Name | 1-O-[(4-fluorophenyl)methyl] 4-O-(2-methylhexan-3-yl) butanedioate |
|---|---|
| PubChem CID | 91704442 |
| Molecular Formula | C18H25FO4 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 1-O-[(4-fluorophenyl)methyl] 4-O-(2-methylhexan-3-yl) butanedioate |
| SMILES | CCCC(OC(=O)CCC(=O)OCc1ccc(F)cc1)C(C)C |
| InChI | InChI=1S/C18H25FO4/c1-4-5-16(13(2)3)23-18(21)11-10-17(20)22-12-14-6-8-15(19)9-7-14/h6-9,13,16H,4-5,10-12H2,1-3H3 |
| InChIKey | XRWKWVLGFPBEAD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |