About 5-O-(2-methylhexan-3-yl) 1-O-(1-phenylethyl) pentanedioate
5-O-(2-methylhexan-3-yl) 1-O-(1-phenylethyl) pentanedioate (PubChem CID 91703850) has the molecular formula C20H30O4
and a molecular weight of 334.46 g/mol. Its IUPAC name is 5-O-(2-methylhexan-3-yl) 1-O-(1-phenylethyl) pentanedioate.
Molecular Properties
| Compound Name | 5-O-(2-methylhexan-3-yl) 1-O-(1-phenylethyl) pentanedioate |
| PubChem CID | 91703850 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 5-O-(2-methylhexan-3-yl) 1-O-(1-phenylethyl) pentanedioate |
| SMILES | CCCC(OC(=O)CCCC(=O)OC(C)c1ccccc1)C(C)C |
| InChI | InChI=1S/C20H30O4/c1-5-10-18(15(2)3)24-20(22)14-9-13-19(21)23-16(4)17-11-7-6-8-12-17/h6-8,11-12,15-16,18H,5,9-10,13-14H2,1-4H3 |
| InChIKey | ASVFVAAPRBILGE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-O-(2-methylhexan-3-yl) 1-O-(1-phenylethyl) pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-(2-methylhexan-3-yl) 1-O-(1-phenylethyl) pentanedioate?
The IUPAC name of 5-O-(2-methylhexan-3-yl) 1-O-(1-phenylethyl) pentanedioate (CID 91703850) is 5-O-(2-methylhexan-3-yl) 1-O-(1-phenylethyl) pentanedioate.
What is the SMILES notation for 5-O-(2-methylhexan-3-yl) 1-O-(1-phenylethyl) pentanedioate?
The canonical SMILES for 5-O-(2-methylhexan-3-yl) 1-O-(1-phenylethyl) pentanedioate is CCCC(OC(=O)CCCC(=O)OC(C)c1ccccc1)C(C)C.
What is the InChIKey of 5-O-(2-methylhexan-3-yl) 1-O-(1-phenylethyl) pentanedioate?
The InChIKey is ASVFVAAPRBILGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30O4/c1-5-10-18(15(2)3)24-20(22)14-9-13-19(21)23-16(4)17-11-7-6-8-12-17/h6-8,11-12,15-16,18H,5,9-10,13-14H2,1-4H3.
What are the key properties of 5-O-(2-methylhexan-3-yl) 1-O-(1-phenylethyl) pentanedioate?
5-O-(2-methylhexan-3-yl) 1-O-(1-phenylethyl) pentanedioate has a molecular weight of 334.46 g/mol, XLogP of 4.83, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-(2-methylhexan-3-yl) 1-O-(1-phenylethyl) pentanedioate is sourced from PubChem (CID 91703850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).