C18H24Cl2O4 — CID 91709385
1-O-(2,3-dichlorophenyl) 5-O-(2-methylhexan-3-yl) pentanedioate (PubChem CID 91709385) has the molecular formula C18H24Cl2O4 and a molecular weight of 375.29 g/mol. Its IUPAC name is 1-O-(2,3-dichlorophenyl) 5-O-(2-methylhexan-3-yl) pentanedioate.
| Compound Name | 1-O-(2,3-dichlorophenyl) 5-O-(2-methylhexan-3-yl) pentanedioate |
|---|---|
| PubChem CID | 91709385 |
| Molecular Formula | C18H24Cl2O4 |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 1-O-(2,3-dichlorophenyl) 5-O-(2-methylhexan-3-yl) pentanedioate |
| SMILES | CCCC(OC(=O)CCCC(=O)Oc1cccc(Cl)c1Cl)C(C)C |
| InChI | InChI=1S/C18H24Cl2O4/c1-4-7-14(12(2)3)23-16(21)10-6-11-17(22)24-15-9-5-8-13(19)18(15)20/h5,8-9,12,14H,4,6-7,10-11H2,1-3H3 |
| InChIKey | SOEUJDUFPZYMCU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|