C19H27ClO5 — CID 91719159
1-O-[2-(2-chlorophenoxy)ethyl] 4-O-(2-methylhexan-3-yl) butanedioate (PubChem CID 91719159) has the molecular formula C19H27ClO5 and a molecular weight of 370.87 g/mol. Its IUPAC name is 1-O-[2-(2-chlorophenoxy)ethyl] 4-O-(2-methylhexan-3-yl) butanedioate.
| Compound Name | 1-O-[2-(2-chlorophenoxy)ethyl] 4-O-(2-methylhexan-3-yl) butanedioate |
|---|---|
| PubChem CID | 91719159 |
| Molecular Formula | C19H27ClO5 |
| Molecular Weight | 370.87 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 1-O-[2-(2-chlorophenoxy)ethyl] 4-O-(2-methylhexan-3-yl) butanedioate |
| SMILES | CCCC(OC(=O)CCC(=O)OCCOc1ccccc1Cl)C(C)C |
| InChI | InChI=1S/C19H27ClO5/c1-4-7-16(14(2)3)25-19(22)11-10-18(21)24-13-12-23-17-9-6-5-8-15(17)20/h5-6,8-9,14,16H,4,7,10-13H2,1-3H3 |
| InChIKey | YZWIWRJZURBTNK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.87 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|