About 1-O-[2-(4-chlorophenyl)ethyl] 4-O-(2-methylhexan-3-yl) butanedioate
1-O-[2-(4-chlorophenyl)ethyl] 4-O-(2-methylhexan-3-yl) butanedioate (PubChem CID 91715983) has the molecular formula C19H27ClO4
and a molecular weight of 354.87 g/mol. Its IUPAC name is 1-O-[2-(4-chlorophenyl)ethyl] 4-O-(2-methylhexan-3-yl) butanedioate.
Molecular Properties
| Compound Name | 1-O-[2-(4-chlorophenyl)ethyl] 4-O-(2-methylhexan-3-yl) butanedioate |
| PubChem CID | 91715983 |
| Molecular Formula | C19H27ClO4 |
| Molecular Weight | 354.87 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1-O-[2-(4-chlorophenyl)ethyl] 4-O-(2-methylhexan-3-yl) butanedioate |
| SMILES | CCCC(OC(=O)CCC(=O)OCCc1ccc(Cl)cc1)C(C)C |
| InChI | InChI=1S/C19H27ClO4/c1-4-5-17(14(2)3)24-19(22)11-10-18(21)23-13-12-15-6-8-16(20)9-7-15/h6-9,14,17H,4-5,10-13H2,1-3H3 |
| InChIKey | VFMOXKXOTSYBHL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.87 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-O-[2-(4-chlorophenyl)ethyl] 4-O-(2-methylhexan-3-yl) butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[2-(4-chlorophenyl)ethyl] 4-O-(2-methylhexan-3-yl) butanedioate?
The IUPAC name of 1-O-[2-(4-chlorophenyl)ethyl] 4-O-(2-methylhexan-3-yl) butanedioate (CID 91715983) is 1-O-[2-(4-chlorophenyl)ethyl] 4-O-(2-methylhexan-3-yl) butanedioate.
What is the SMILES notation for 1-O-[2-(4-chlorophenyl)ethyl] 4-O-(2-methylhexan-3-yl) butanedioate?
The canonical SMILES for 1-O-[2-(4-chlorophenyl)ethyl] 4-O-(2-methylhexan-3-yl) butanedioate is CCCC(OC(=O)CCC(=O)OCCc1ccc(Cl)cc1)C(C)C.
What is the InChIKey of 1-O-[2-(4-chlorophenyl)ethyl] 4-O-(2-methylhexan-3-yl) butanedioate?
The InChIKey is VFMOXKXOTSYBHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27ClO4/c1-4-5-17(14(2)3)24-19(22)11-10-18(21)23-13-12-15-6-8-16(20)9-7-15/h6-9,14,17H,4-5,10-13H2,1-3H3.
What are the key properties of 1-O-[2-(4-chlorophenyl)ethyl] 4-O-(2-methylhexan-3-yl) butanedioate?
1-O-[2-(4-chlorophenyl)ethyl] 4-O-(2-methylhexan-3-yl) butanedioate has a molecular weight of 354.87 g/mol, XLogP of 4.57, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[2-(4-chlorophenyl)ethyl] 4-O-(2-methylhexan-3-yl) butanedioate is sourced from PubChem (CID 91715983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).