C24H36Cl2O4 — CID 91729008
1-O-[(2,5-dichlorophenyl)methyl] 10-O-(2-methylhexan-3-yl) decanedioate (PubChem CID 91729008) has the molecular formula C24H36Cl2O4 and a molecular weight of 459.45 g/mol. Its IUPAC name is 1-O-[(2,5-dichlorophenyl)methyl] 10-O-(2-methylhexan-3-yl) decanedioate.
| Compound Name | 1-O-[(2,5-dichlorophenyl)methyl] 10-O-(2-methylhexan-3-yl) decanedioate |
|---|---|
| PubChem CID | 91729008 |
| Molecular Formula | C24H36Cl2O4 |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 1-O-[(2,5-dichlorophenyl)methyl] 10-O-(2-methylhexan-3-yl) decanedioate |
| SMILES | CCCC(OC(=O)CCCCCCCCC(=O)OCc1cc(Cl)ccc1Cl)C(C)C |
| InChI | InChI=1S/C24H36Cl2O4/c1-4-11-22(18(2)3)30-24(28)13-10-8-6-5-7-9-12-23(27)29-17-19-16-20(25)14-15-21(19)26/h14-16,18,22H,4-13,17H2,1-3H3 |
| InChIKey | ZPMZTWOYEMTGKZ-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|