C20H29NO7 — CID 91724292
1-O-[(4-methoxy-3-nitrophenyl)methyl] 5-O-(2-methylhexan-3-yl) pentanedioate (PubChem CID 91724292) has the molecular formula C20H29NO7 and a molecular weight of 395.45 g/mol. Its IUPAC name is 1-O-[(4-methoxy-3-nitrophenyl)methyl] 5-O-(2-methylhexan-3-yl) pentanedioate.
| Compound Name | 1-O-[(4-methoxy-3-nitrophenyl)methyl] 5-O-(2-methylhexan-3-yl) pentanedioate |
|---|---|
| PubChem CID | 91724292 |
| Molecular Formula | C20H29NO7 |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 1-O-[(4-methoxy-3-nitrophenyl)methyl] 5-O-(2-methylhexan-3-yl) pentanedioate |
| SMILES | CCCC(OC(=O)CCCC(=O)OCc1ccc(OC)c([N+](=O)[O-])c1)C(C)C |
| InChI | InChI=1S/C20H29NO7/c1-5-7-17(14(2)3)28-20(23)9-6-8-19(22)27-13-15-10-11-18(26-4)16(12-15)21(24)25/h10-12,14,17H,5-9,13H2,1-4H3 |
| InChIKey | SBRDMBLPEXVPEJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|