C11H16N2O3S — CID 66218983
1-[(4-methoxy-3-nitrophenyl)methylsulfanyl]propan-2-amine (PubChem CID 66218983) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 1-[(4-methoxy-3-nitrophenyl)methylsulfanyl]propan-2-amine.
| Compound Name | 1-[(4-methoxy-3-nitrophenyl)methylsulfanyl]propan-2-amine |
|---|---|
| PubChem CID | 66218983 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 1-[(4-methoxy-3-nitrophenyl)methylsulfanyl]propan-2-amine |
| SMILES | COc1ccc(CSCC(C)N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16N2O3S/c1-8(12)6-17-7-9-3-4-11(16-2)10(5-9)13(14)15/h3-5,8H,6-7,12H2,1-2H3 |
| InChIKey | INJWGLAMTSZQDT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|