C10H13NO4S — CID 43502604
2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]ethanol (PubChem CID 43502604) has the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. Its IUPAC name is 2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]ethanol.
| Compound Name | 2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]ethanol |
|---|---|
| PubChem CID | 43502604 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]ethanol |
| SMILES | COc1ccc(CSCCO)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H13NO4S/c1-15-10-3-2-8(7-16-5-4-12)6-9(10)11(13)14/h2-3,6,12H,4-5,7H2,1H3 |
| InChIKey | UKTHVIXPMSKTGD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|