C12H17NO4S — CID 66137956
3-[(4-methoxy-3-nitrophenyl)methylsulfanyl]butan-1-ol (PubChem CID 66137956) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is 3-[(4-methoxy-3-nitrophenyl)methylsulfanyl]butan-1-ol.
| Compound Name | 3-[(4-methoxy-3-nitrophenyl)methylsulfanyl]butan-1-ol |
|---|---|
| PubChem CID | 66137956 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 3-[(4-methoxy-3-nitrophenyl)methylsulfanyl]butan-1-ol |
| SMILES | COc1ccc(CSC(C)CCO)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17NO4S/c1-9(5-6-14)18-8-10-3-4-12(17-2)11(7-10)13(15)16/h3-4,7,9,14H,5-6,8H2,1-2H3 |
| InChIKey | WAGPXYPRGWEQDS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|