C12H18ClN2O5- — CID 53347640
2-[2-hydroxyethyl-[(4-methoxy-3-nitrophenyl)methyl]amino]ethanol chloride (PubChem CID 53347640) has the molecular formula C12H18ClN2O5- and a molecular weight of 305.74 g/mol. Its IUPAC name is 2-[2-hydroxyethyl-[(4-methoxy-3-nitrophenyl)methyl]amino]ethanol chloride.
| Compound Name | 2-[2-hydroxyethyl-[(4-methoxy-3-nitrophenyl)methyl]amino]ethanol chloride |
|---|---|
| PubChem CID | 53347640 |
| Molecular Formula | C12H18ClN2O5- |
| Molecular Weight | 305.74 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2-[2-hydroxyethyl-[(4-methoxy-3-nitrophenyl)methyl]amino]ethanol chloride |
| SMILES | COc1ccc(CN(CCO)CCO)cc1[N+](=O)[O-].[Cl-] |
| InChI | InChI=1S/C12H18N2O5.ClH/c1-19-12-3-2-10(8-11(12)14(17)18)9-13(4-6-15)5-7-16;/h2-3,8,15-16H,4-7,9H2,1H3;1H/p-1 |
| InChIKey | OFIBISYBGYZHGJ-UHFFFAOYSA-M |
| XLogP | -2.61 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.74 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|