C20H26BrN3O3 — CID 23766334
N'-[(4-bromophenyl)methyl]-N'-[(4-methoxy-3-nitrophenyl)methyl]-2,2-dimethylpropane-1,3-diamine (PubChem CID 23766334) has the molecular formula C20H26BrN3O3 and a molecular weight of 436.35 g/mol. Its IUPAC name is N'-[(4-bromophenyl)methyl]-N'-[(4-methoxy-3-nitrophenyl)methyl]-2,2-dimethylpropane-1,3-diamine.
| Compound Name | N'-[(4-bromophenyl)methyl]-N'-[(4-methoxy-3-nitrophenyl)methyl]-2,2-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 23766334 |
| Molecular Formula | C20H26BrN3O3 |
| Molecular Weight | 436.35 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | N'-[(4-bromophenyl)methyl]-N'-[(4-methoxy-3-nitrophenyl)methyl]-2,2-dimethylpropane-1,3-diamine |
| SMILES | COc1ccc(CN(Cc2ccc(Br)cc2)CC(C)(C)CN)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H26BrN3O3/c1-20(2,13-22)14-23(11-15-4-7-17(21)8-5-15)12-16-6-9-19(27-3)18(10-16)24(25)26/h4-10H,11-14,22H2,1-3H3 |
| InChIKey | VLGDRPJYQYSYTD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.35 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|