C22H30BrN3O5 — CID 23877736
N'-[(3-bromo-4-methoxyphenyl)methyl]-N'-[(4,5-dimethoxy-2-nitrophenyl)methyl]-2,2-dimethylpropane-1,3-diamine (PubChem CID 23877736) has the molecular formula C22H30BrN3O5 and a molecular weight of 496.40 g/mol. Its IUPAC name is N'-[(3-bromo-4-methoxyphenyl)methyl]-N'-[(4,5-dimethoxy-2-nitrophenyl)methyl]-2,2-dimethylpropane-1,3-diamine.
| Compound Name | N'-[(3-bromo-4-methoxyphenyl)methyl]-N'-[(4,5-dimethoxy-2-nitrophenyl)methyl]-2,2-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 23877736 |
| Molecular Formula | C22H30BrN3O5 |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | N'-[(3-bromo-4-methoxyphenyl)methyl]-N'-[(4,5-dimethoxy-2-nitrophenyl)methyl]-2,2-dimethylpropane-1,3-diamine |
| SMILES | COc1ccc(CN(Cc2cc(OC)c(OC)cc2[N+](=O)[O-])CC(C)(C)CN)cc1Br |
| InChI | InChI=1S/C22H30BrN3O5/c1-22(2,13-24)14-25(11-15-6-7-19(29-3)17(23)8-15)12-16-9-20(30-4)21(31-5)10-18(16)26(27)28/h6-10H,11-14,24H2,1-5H3 |
| InChIKey | KJLKWTONHHCRSH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 100.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|