C26H37N3O4 — CID 23851495
4-N-[(4-tert-butylphenyl)methyl]-4-N-[(4,5-dimethoxy-2-nitrophenyl)methyl]cyclohexane-1,4-diamine (PubChem CID 23851495) has the molecular formula C26H37N3O4 and a molecular weight of 455.60 g/mol. Its IUPAC name is 4-N-[(4-tert-butylphenyl)methyl]-4-N-[(4,5-dimethoxy-2-nitrophenyl)methyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[(4-tert-butylphenyl)methyl]-4-N-[(4,5-dimethoxy-2-nitrophenyl)methyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 23851495 |
| Molecular Formula | C26H37N3O4 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | 4-N-[(4-tert-butylphenyl)methyl]-4-N-[(4,5-dimethoxy-2-nitrophenyl)methyl]cyclohexane-1,4-diamine |
| SMILES | COc1cc(CN(Cc2ccc(C(C)(C)C)cc2)C2CCC(N)CC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C26H37N3O4/c1-26(2,3)20-8-6-18(7-9-20)16-28(22-12-10-21(27)11-13-22)17-19-14-24(32-4)25(33-5)15-23(19)29(30)31/h6-9,14-15,21-22H,10-13,16-17,27H2,1-5H3 |
| InChIKey | QJQBBLOAOKIKHE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|