C18H29N3O2 — CID 23732317
4-N-(2-methylbutyl)-4-N-[(4-nitrophenyl)methyl]cyclohexane-1,4-diamine (PubChem CID 23732317) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 4-N-(2-methylbutyl)-4-N-[(4-nitrophenyl)methyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-(2-methylbutyl)-4-N-[(4-nitrophenyl)methyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 23732317 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 4-N-(2-methylbutyl)-4-N-[(4-nitrophenyl)methyl]cyclohexane-1,4-diamine |
| SMILES | CCC(C)CN(Cc1ccc([N+](=O)[O-])cc1)C1CCC(N)CC1 |
| InChI | InChI=1S/C18H29N3O2/c1-3-14(2)12-20(17-10-6-16(19)7-11-17)13-15-4-8-18(9-5-15)21(22)23/h4-5,8-9,14,16-17H,3,6-7,10-13,19H2,1-2H3 |
| InChIKey | PZAXSTMCMXCVFN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|