C13H21Cl2N3O2 — CID 86277411
4-N-[(4-nitrophenyl)methyl]cyclohexane-1,4-diamine;dihydrochloride (PubChem CID 86277411) has the molecular formula C13H21Cl2N3O2 and a molecular weight of 322.24 g/mol. Its IUPAC name is 4-N-[(4-nitrophenyl)methyl]cyclohexane-1,4-diamine;dihydrochloride.
| Compound Name | 4-N-[(4-nitrophenyl)methyl]cyclohexane-1,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 86277411 |
| Molecular Formula | C13H21Cl2N3O2 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 4-N-[(4-nitrophenyl)methyl]cyclohexane-1,4-diamine;dihydrochloride |
| SMILES | Cl.Cl.NC1CCC(NCc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C13H19N3O2.2ClH/c14-11-3-5-12(6-4-11)15-9-10-1-7-13(8-2-10)16(17)18;;/h1-2,7-8,11-12,15H,3-6,9,14H2;2*1H |
| InChIKey | BRTZHVHTIIQJDQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|