C14H22N2O2 — CID 143890490
4-N-benzylcyclohexane-1,4-diamine;formic acid (PubChem CID 143890490) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 4-N-benzylcyclohexane-1,4-diamine;formic acid.
| Compound Name | 4-N-benzylcyclohexane-1,4-diamine;formic acid |
|---|---|
| PubChem CID | 143890490 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 4-N-benzylcyclohexane-1,4-diamine;formic acid |
| SMILES | NC1CCC(NCc2ccccc2)CC1.O=CO |
| InChI | InChI=1S/C13H20N2.CH2O2/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11;2-1-3/h1-5,12-13,15H,6-10,14H2;1H,(H,2,3) |
| InChIKey | XTPPIFIFJLEPHS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|