About benzene;N-benzylcyclohexanamine
benzene;N-benzylcyclohexanamine (PubChem CID 142622843) has the molecular formula C19H25N
and a molecular weight of 267.42 g/mol. Its IUPAC name is benzene;N-benzylcyclohexanamine.
Molecular Properties
| Compound Name | benzene;N-benzylcyclohexanamine |
| PubChem CID | 142622843 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | benzene;N-benzylcyclohexanamine |
| SMILES | c1ccc(CNC2CCCCC2)cc1.c1ccccc1 |
| InChI | InChI=1S/C13H19N.C6H6/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13;1-2-4-6-5-3-1/h1,3-4,7-8,13-14H,2,5-6,9-11H2;1-6H |
| InChIKey | PREUYDMBKYBZDB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzene;N-benzylcyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;N-benzylcyclohexanamine?
The IUPAC name of benzene;N-benzylcyclohexanamine (CID 142622843) is benzene;N-benzylcyclohexanamine.
What is the SMILES notation for benzene;N-benzylcyclohexanamine?
The canonical SMILES for benzene;N-benzylcyclohexanamine is c1ccc(CNC2CCCCC2)cc1.c1ccccc1.
What is the InChIKey of benzene;N-benzylcyclohexanamine?
The InChIKey is PREUYDMBKYBZDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N.C6H6/c1-3-7-12(8-4-1)11-14-13-9-5-2-6-10-13;1-2-4-6-5-3-1/h1,3-4,7-8,13-14H,2,5-6,9-11H2;1-6H.
What are the key properties of benzene;N-benzylcyclohexanamine?
benzene;N-benzylcyclohexanamine has a molecular weight of 267.42 g/mol, XLogP of 4.80, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;N-benzylcyclohexanamine is sourced from PubChem (CID 142622843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).