C13H20N2 — CID 71627766
N-benzyl-N'-cyclobutylethane-1,2-diamine (PubChem CID 71627766) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is N-benzyl-N'-cyclobutylethane-1,2-diamine.
| Compound Name | N-benzyl-N'-cyclobutylethane-1,2-diamine |
|---|---|
| PubChem CID | 71627766 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | N-benzyl-N'-cyclobutylethane-1,2-diamine |
| SMILES | c1ccc(CNCCNC2CCC2)cc1 |
| InChI | InChI=1S/C13H20N2/c1-2-5-12(6-3-1)11-14-9-10-15-13-7-4-8-13/h1-3,5-6,13-15H,4,7-11H2 |
| InChIKey | SICGNIQRSIZMIN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|