C19H24N2 — CID 69114747
4-[(cyclohexylamino)methyl]-N-phenylaniline (PubChem CID 69114747) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 4-[(cyclohexylamino)methyl]-N-phenylaniline.
| Compound Name | 4-[(cyclohexylamino)methyl]-N-phenylaniline |
|---|---|
| PubChem CID | 69114747 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 4-[(cyclohexylamino)methyl]-N-phenylaniline |
| SMILES | c1ccc(Nc2ccc(CNC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C19H24N2/c1-3-7-17(8-4-1)20-15-16-11-13-19(14-12-16)21-18-9-5-2-6-10-18/h2,5-6,9-14,17,20-21H,1,3-4,7-8,15H2 |
| InChIKey | BAJYLGQOPMQTQU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |