C16H24ClNO2 — CID 17158513
4-[(cyclooctylamino)methyl]benzoic acid;hydrochloride (PubChem CID 17158513) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is 4-[(cyclooctylamino)methyl]benzoic acid;hydrochloride.
| Compound Name | 4-[(cyclooctylamino)methyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 17158513 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 4-[(cyclooctylamino)methyl]benzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc(CNC2CCCCCCC2)cc1 |
| InChI | InChI=1S/C16H23NO2.ClH/c18-16(19)14-10-8-13(9-11-14)12-17-15-6-4-2-1-3-5-7-15;/h8-11,15,17H,1-7,12H2,(H,18,19);1H |
| InChIKey | ZRKZDSPAFWDLRB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |