C25H41N3O2 — CID 23993708
4-[[4-[2-methylbutyl-[(4-nitrophenyl)methyl]amino]cyclohexyl]methyl]cyclohexan-1-amine (PubChem CID 23993708) has the molecular formula C25H41N3O2 and a molecular weight of 415.62 g/mol. Its IUPAC name is 4-[[4-[2-methylbutyl-[(4-nitrophenyl)methyl]amino]cyclohexyl]methyl]cyclohexan-1-amine.
| Compound Name | 4-[[4-[2-methylbutyl-[(4-nitrophenyl)methyl]amino]cyclohexyl]methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 23993708 |
| Molecular Formula | C25H41N3O2 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.32 |
| IUPAC Name | 4-[[4-[2-methylbutyl-[(4-nitrophenyl)methyl]amino]cyclohexyl]methyl]cyclohexan-1-amine |
| SMILES | CCC(C)CN(Cc1ccc([N+](=O)[O-])cc1)C1CCC(CC2CCC(N)CC2)CC1 |
| InChI | InChI=1S/C25H41N3O2/c1-3-19(2)17-27(18-22-8-14-25(15-9-22)28(29)30)24-12-6-21(7-13-24)16-20-4-10-23(26)11-5-20/h8-9,14-15,19-21,23-24H,3-7,10-13,16-18,26H2,1-2H3 |
| InChIKey | HKPXEHAGTWDQEF-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|