C27H41N5O4 — CID 23823300
(2R)-N-(4-aminocyclohexyl)-1-(cyclopropanecarbonyl)-4-[2-methylpropyl-[(4-nitrophenyl)methyl]amino]piperidine-2-carboxamide (PubChem CID 23823300) has the molecular formula C27H41N5O4 and a molecular weight of 499.66 g/mol. Its IUPAC name is (2R)-N-(4-aminocyclohexyl)-1-(cyclopropanecarbonyl)-4-[2-methylpropyl-[(4-nitrophenyl)methyl]amino]piperidine-2-carboxamide.
| Compound Name | (2R)-N-(4-aminocyclohexyl)-1-(cyclopropanecarbonyl)-4-[2-methylpropyl-[(4-nitrophenyl)methyl]amino]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 23823300 |
| Molecular Formula | C27H41N5O4 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.32 |
| IUPAC Name | (2R)-N-(4-aminocyclohexyl)-1-(cyclopropanecarbonyl)-4-[2-methylpropyl-[(4-nitrophenyl)methyl]amino]piperidine-2-carboxamide |
| SMILES | CC(C)CN(Cc1ccc([N+](=O)[O-])cc1)C1CCN(C(=O)C2CC2)[C@@H](C(=O)NC2CCC(N)CC2)C1 |
| InChI | InChI=1S/C27H41N5O4/c1-18(2)16-30(17-19-3-11-23(12-4-19)32(35)36)24-13-14-31(27(34)20-5-6-20)25(15-24)26(33)29-22-9-7-21(28)8-10-22/h3-4,11-12,18,20-22,24-25H,5-10,13-17,28H2,1-2H3,(H,29,33)/t21?,22?,24?,25-/m1/s1 |
| InChIKey | LSADYNQSUZSLIN-LDDVEIQISA-N |
| XLogP | 3.21 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|