C26H35N5O4 — CID 23905595
N-(2-aminoethyl)-1-(4-methylbenzoyl)-4-[2-methylpropyl-[(4-nitrophenyl)methyl]amino]pyrrolidine-2-carboxamide (PubChem CID 23905595) has the molecular formula C26H35N5O4 and a molecular weight of 481.60 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(4-methylbenzoyl)-4-[2-methylpropyl-[(4-nitrophenyl)methyl]amino]pyrrolidine-2-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-(4-methylbenzoyl)-4-[2-methylpropyl-[(4-nitrophenyl)methyl]amino]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23905595 |
| Molecular Formula | C26H35N5O4 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | N-(2-aminoethyl)-1-(4-methylbenzoyl)-4-[2-methylpropyl-[(4-nitrophenyl)methyl]amino]pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(C(=O)N2CC(N(Cc3ccc([N+](=O)[O-])cc3)CC(C)C)CC2C(=O)NCCN)cc1 |
| InChI | InChI=1S/C26H35N5O4/c1-18(2)15-29(16-20-6-10-22(11-7-20)31(34)35)23-14-24(25(32)28-13-12-27)30(17-23)26(33)21-8-4-19(3)5-9-21/h4-11,18,23-24H,12-17,27H2,1-3H3,(H,28,32) |
| InChIKey | IQWHLTWRJXFHSG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|