C25H34N6O5S — CID 23791721
N-(2-aminoethyl)-4-[2-morpholin-4-ylethyl-[(4-nitrophenyl)methyl]amino]-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 23791721) has the molecular formula C25H34N6O5S and a molecular weight of 530.65 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-[2-morpholin-4-ylethyl-[(4-nitrophenyl)methyl]amino]-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | N-(2-aminoethyl)-4-[2-morpholin-4-ylethyl-[(4-nitrophenyl)methyl]amino]-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23791721 |
| Molecular Formula | C25H34N6O5S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | N-(2-aminoethyl)-4-[2-morpholin-4-ylethyl-[(4-nitrophenyl)methyl]amino]-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | NCCNC(=O)C1CC(N(CCN2CCOCC2)Cc2ccc([N+](=O)[O-])cc2)CN1C(=O)c1cccs1 |
| InChI | InChI=1S/C25H34N6O5S/c26-7-8-27-24(32)22-16-21(18-30(22)25(33)23-2-1-15-37-23)29(10-9-28-11-13-36-14-12-28)17-19-3-5-20(6-4-19)31(34)35/h1-6,15,21-22H,7-14,16-18,26H2,(H,27,32) |
| InChIKey | KLTJHHVQADJKNO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 134.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|