C28H37N7O5 — CID 23765257
[4-[2-morpholin-4-ylethyl-[(4-nitrophenyl)methyl]amino]-1-(pyridine-3-carbonyl)pyrrolidin-2-yl]-piperazin-1-ylmethanone (PubChem CID 23765257) has the molecular formula C28H37N7O5 and a molecular weight of 551.65 g/mol. Its IUPAC name is [4-[2-morpholin-4-ylethyl-[(4-nitrophenyl)methyl]amino]-1-(pyridine-3-carbonyl)pyrrolidin-2-yl]-piperazin-1-ylmethanone.
| Compound Name | [4-[2-morpholin-4-ylethyl-[(4-nitrophenyl)methyl]amino]-1-(pyridine-3-carbonyl)pyrrolidin-2-yl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 23765257 |
| Molecular Formula | C28H37N7O5 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.29 |
| IUPAC Name | [4-[2-morpholin-4-ylethyl-[(4-nitrophenyl)methyl]amino]-1-(pyridine-3-carbonyl)pyrrolidin-2-yl]-piperazin-1-ylmethanone |
| SMILES | O=C(C1CC(N(CCN2CCOCC2)Cc2ccc([N+](=O)[O-])cc2)CN1C(=O)c1cccnc1)N1CCNCC1 |
| InChI | InChI=1S/C28H37N7O5/c36-27(23-2-1-7-30-19-23)34-21-25(18-26(34)28(37)32-10-8-29-9-11-32)33(13-12-31-14-16-40-17-15-31)20-22-3-5-24(6-4-22)35(38)39/h1-7,19,25-26,29H,8-18,20-21H2 |
| InChIKey | FXBJKYDSXOMING-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 124.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|